C8H19NO4 — CID 158104696
(2S,3R,4S,5R)-1-(methylamino)heptane-2,3,4,5-tetrol (PubChem CID 158104696) has the molecular formula C8H19NO4 and a molecular weight of 193.24 g/mol. Its IUPAC name is (2S,3R,4S,5R)-1-(methylamino)heptane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R)-1-(methylamino)heptane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 158104696 |
| Molecular Formula | C8H19NO4 |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (2S,3R,4S,5R)-1-(methylamino)heptane-2,3,4,5-tetrol |
| SMILES | CC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CNC |
| InChI | InChI=1S/C8H19NO4/c1-3-5(10)7(12)8(13)6(11)4-9-2/h5-13H,3-4H2,1-2H3/t5-,6+,7+,8-/m1/s1 |
| InChIKey | LQXJIUAAOBELIW-VGRMVHKJSA-N |
| XLogP | -1.94 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |