C13H29NO5 — CID 140845274
1-(methylamino)dodecane-2,3,4,5,6-pentol (PubChem CID 140845274) has the molecular formula C13H29NO5 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-(methylamino)dodecane-2,3,4,5,6-pentol.
| Compound Name | 1-(methylamino)dodecane-2,3,4,5,6-pentol |
|---|---|
| PubChem CID | 140845274 |
| Molecular Formula | C13H29NO5 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1-(methylamino)dodecane-2,3,4,5,6-pentol |
| SMILES | CCCCCCC(O)C(O)C(O)C(O)C(O)CNC |
| InChI | InChI=1S/C13H29NO5/c1-3-4-5-6-7-9(15)11(17)13(19)12(18)10(16)8-14-2/h9-19H,3-8H2,1-2H3 |
| InChIKey | SYXWRMWENXOIBZ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|