C7H17NO5 — CID 89253185
(2R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (PubChem CID 89253185) has the molecular formula C7H17NO5 and a molecular weight of 195.21 g/mol. Its IUPAC name is (2R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 89253185 |
| Molecular Formula | C7H17NO5 |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | (2R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CNC[C@H](O)C(O)C(O)[C@H](O)CO |
| InChI | InChI=1S/C7H17NO5/c1-8-2-4(10)6(12)7(13)5(11)3-9/h4-13H,2-3H2,1H3/t4-,5+,6?,7?/m0/s1 |
| InChIKey | MBBZMMPHUWSWHV-IBJXHFRJSA-N |
| XLogP | -3.36 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |