C10H23FeN4O5S6 — CID 173160651
iron(3+);(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;tricarbamodithioate (PubChem CID 173160651) has the molecular formula C10H23FeN4O5S6 and a molecular weight of 527.56 g/mol. Its IUPAC name is iron(3+);(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;tricarbamodithioate.
| Compound Name | iron(3+);(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;tricarbamodithioate |
|---|---|
| PubChem CID | 173160651 |
| Molecular Formula | C10H23FeN4O5S6 |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 526.93 |
| IUPAC Name | iron(3+);(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;tricarbamodithioate |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.NC(=S)[S-].NC(=S)[S-].NC(=S)[S-].[Fe+3] |
| InChI | InChI=1S/C7H17NO5.3CH3NS2.Fe/c1-8-2-4(10)6(12)7(13)5(11)3-9;3*2-1(3)4;/h4-13H,2-3H2,1H3;3*(H3,2,3,4);/q;;;;+3/p-3/t4-,5+,6+,7+;;;;/m0..../s1 |
| InChIKey | WAOZMJBRYOETRS-SESJOKTNSA-K |
| XLogP | -4.03 |
| TPSA | 191.24 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|