C8H16NO5S2- — CID 7059586
N-methyl-N-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate (PubChem CID 7059586) has the molecular formula C8H16NO5S2- and a molecular weight of 270.35 g/mol. Its IUPAC name is N-methyl-N-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate.
| Compound Name | N-methyl-N-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate |
|---|---|
| PubChem CID | 7059586 |
| Molecular Formula | C8H16NO5S2- |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | N-methyl-N-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate |
| SMILES | CN(C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=S)[S-] |
| InChI | InChI=1S/C8H17NO5S2/c1-9(8(15)16)2-4(11)6(13)7(14)5(12)3-10/h4-7,10-14H,2-3H2,1H3,(H,15,16)/p-1/t4-,5-,6-,7-/m1/s1 |
| InChIKey | IBVJFULICYLKCE-DBRKOABJSA-M |
| XLogP | -2.81 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|