C8H20ClNO5 — CID 169438924
(2R,3R,4R,5S)-6-(dimethylamino)hexane-1,2,3,4,5-pentol;hydrochloride (PubChem CID 169438924) has the molecular formula C8H20ClNO5 and a molecular weight of 245.70 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-(dimethylamino)hexane-1,2,3,4,5-pentol;hydrochloride.
| Compound Name | (2R,3R,4R,5S)-6-(dimethylamino)hexane-1,2,3,4,5-pentol;hydrochloride |
|---|---|
| PubChem CID | 169438924 |
| Molecular Formula | C8H20ClNO5 |
| Molecular Weight | 245.70 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | (2R,3R,4R,5S)-6-(dimethylamino)hexane-1,2,3,4,5-pentol;hydrochloride |
| SMILES | CN(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.Cl |
| InChI | InChI=1S/C8H19NO5.ClH/c1-9(2)3-5(11)7(13)8(14)6(12)4-10;/h5-8,10-14H,3-4H2,1-2H3;1H/t5-,6+,7+,8+;/m0./s1 |
| InChIKey | LQHDEGQXAYWMIZ-ANJNCBFHSA-N |
| XLogP | -2.59 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.70 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |