C10H25NO5 — CID 171505184
6-(dimethylamino)hexane-1,2,3,4,5-pentol;ethane (PubChem CID 171505184) has the molecular formula C10H25NO5 and a molecular weight of 239.31 g/mol. Its IUPAC name is 6-(dimethylamino)hexane-1,2,3,4,5-pentol;ethane.
| Compound Name | 6-(dimethylamino)hexane-1,2,3,4,5-pentol;ethane |
|---|---|
| PubChem CID | 171505184 |
| Molecular Formula | C10H25NO5 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 6-(dimethylamino)hexane-1,2,3,4,5-pentol;ethane |
| SMILES | CC.CN(C)CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H19NO5.C2H6/c1-9(2)3-5(11)7(13)8(14)6(12)4-10;1-2/h5-8,10-14H,3-4H2,1-2H3;1-2H3 |
| InChIKey | LFDUMYYSRVMFPA-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |