C10H23NO5 — CID 58957788
(2R,3R,4R,5S)-6-[methyl(propan-2-yl)amino]hexane-1,2,3,4,5-pentol (PubChem CID 58957788) has the molecular formula C10H23NO5 and a molecular weight of 237.30 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[methyl(propan-2-yl)amino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[methyl(propan-2-yl)amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 58957788 |
| Molecular Formula | C10H23NO5 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | (2R,3R,4R,5S)-6-[methyl(propan-2-yl)amino]hexane-1,2,3,4,5-pentol |
| SMILES | CC(C)N(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H23NO5/c1-6(2)11(3)4-7(13)9(15)10(16)8(14)5-12/h6-10,12-16H,4-5H2,1-3H3/t7-,8+,9+,10+/m0/s1 |
| InChIKey | OAFLMLMUKJKSER-SGIHWFKDSA-N |
| XLogP | -2.24 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |