C5H14Cl2O5 — CID 175842943
pentane-1,2,3,4,5-pentol;dihydrochloride (PubChem CID 175842943) has the molecular formula C5H14Cl2O5 and a molecular weight of 225.07 g/mol. Its IUPAC name is pentane-1,2,3,4,5-pentol;dihydrochloride.
| Compound Name | pentane-1,2,3,4,5-pentol;dihydrochloride |
|---|---|
| PubChem CID | 175842943 |
| Molecular Formula | C5H14Cl2O5 |
| Molecular Weight | 225.07 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | pentane-1,2,3,4,5-pentol;dihydrochloride |
| SMILES | Cl.Cl.OCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C5H12O5.2ClH/c6-1-3(8)5(10)4(9)2-7;;/h3-10H,1-2H2;2*1H |
| InChIKey | ULFZGIKFROCOMK-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.07 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |