C10H24O10 — CID 139064085
(2S,4S)-pentane-1,2,3,4,5-pentol (PubChem CID 139064085) has the molecular formula C10H24O10 and a molecular weight of 304.29 g/mol. Its IUPAC name is (2S,4S)-pentane-1,2,3,4,5-pentol.
| Compound Name | (2S,4S)-pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 139064085 |
| Molecular Formula | C10H24O10 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (2S,4S)-pentane-1,2,3,4,5-pentol |
| SMILES | OC[C@H](O)C(O)[C@@H](O)CO.OC[C@H](O)C(O)[C@@H](O)CO |
| InChI | InChI=1S/2C5H12O5/c2*6-1-3(8)5(10)4(9)2-7/h2*3-10H,1-2H2/t2*3-,4-/m00/s1 |
| InChIKey | FQGHKOSYVJVDKX-IHZAQJADSA-N |
| XLogP | -5.89 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |