C5H13ClO5 — CID 158818739
(2R,4R)-pentane-1,2,3,4,5-pentol;hydrochloride (PubChem CID 158818739) has the molecular formula C5H13ClO5 and a molecular weight of 188.61 g/mol. Its IUPAC name is (2R,4R)-pentane-1,2,3,4,5-pentol;hydrochloride.
| Compound Name | (2R,4R)-pentane-1,2,3,4,5-pentol;hydrochloride |
|---|---|
| PubChem CID | 158818739 |
| Molecular Formula | C5H13ClO5 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (2R,4R)-pentane-1,2,3,4,5-pentol;hydrochloride |
| SMILES | Cl.OC[C@@H](O)C(O)[C@H](O)CO |
| InChI | InChI=1S/C5H12O5.ClH/c6-1-3(8)5(10)4(9)2-7;/h3-10H,1-2H2;1H/t3-,4-;/m1./s1 |
| InChIKey | IVPFCJFBIPBZJQ-VKKIDBQXSA-N |
| XLogP | -2.52 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |