C12H21NNa2O7S2 — CID 177274124
disodium;3-methyl-2-[2,3,4,5,6-pentahydroxyhexyl(sulfidocarbothioyl)amino]butanoate (PubChem CID 177274124) has the molecular formula C12H21NNa2O7S2 and a molecular weight of 401.41 g/mol. Its IUPAC name is disodium;3-methyl-2-[2,3,4,5,6-pentahydroxyhexyl(sulfidocarbothioyl)amino]butanoate.
| Compound Name | disodium;3-methyl-2-[2,3,4,5,6-pentahydroxyhexyl(sulfidocarbothioyl)amino]butanoate |
|---|---|
| PubChem CID | 177274124 |
| Molecular Formula | C12H21NNa2O7S2 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | disodium;3-methyl-2-[2,3,4,5,6-pentahydroxyhexyl(sulfidocarbothioyl)amino]butanoate |
| SMILES | CC(C)C(C(=O)[O-])N(CC(O)C(O)C(O)C(O)CO)C(=S)[S-].[Na+].[Na+] |
| InChI | InChI=1S/C12H23NO7S2.2Na/c1-5(2)8(11(19)20)13(12(21)22)3-6(15)9(17)10(18)7(16)4-14;;/h5-10,14-18H,3-4H2,1-2H3,(H,19,20)(H,21,22);;/q;2*+1/p-2 |
| InChIKey | INIXFVHMRZWASE-UHFFFAOYSA-L |
| XLogP | -9.66 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | -9.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|