C9H16CaO10 — CID 11244225
calcium;2-hydroxypropanoate;2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 11244225) has the molecular formula C9H16CaO10 and a molecular weight of 324.30 g/mol. Its IUPAC name is calcium;2-hydroxypropanoate;2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | calcium;2-hydroxypropanoate;2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 11244225 |
| Molecular Formula | C9H16CaO10 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | calcium;2-hydroxypropanoate;2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | CC(O)C(=O)[O-].O=C([O-])C(O)C(O)C(O)C(O)CO.[Ca+2] |
| InChI | InChI=1S/C6H12O7.C3H6O3.Ca/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-2(4)3(5)6;/h2-5,7-11H,1H2,(H,12,13);2,4H,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | PWKNEBQRTUXXLT-UHFFFAOYSA-L |
| XLogP | -7.09 |
| TPSA | 201.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | -7.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |