C6H14NaO11Sb — CID 175025201
sodium;2,3,4,5,6-pentahydroxyhexanoate;stiboric acid (PubChem CID 175025201) has the molecular formula C6H14NaO11Sb and a molecular weight of 406.92 g/mol. Its IUPAC name is sodium;2,3,4,5,6-pentahydroxyhexanoate;stiboric acid.
| Compound Name | sodium;2,3,4,5,6-pentahydroxyhexanoate;stiboric acid |
|---|---|
| PubChem CID | 175025201 |
| Molecular Formula | C6H14NaO11Sb |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 405.95 |
| IUPAC Name | sodium;2,3,4,5,6-pentahydroxyhexanoate;stiboric acid |
| SMILES | O=C([O-])C(O)C(O)C(O)C(O)CO.O=[Sb](O)(O)O.[Na+] |
| InChI | InChI=1S/C6H12O7.Na.3H2O.O.Sb/c7-1-2(8)3(9)4(10)5(11)6(12)13;;;;;;/h2-5,7-11H,1H2,(H,12,13);;3*1H2;;/q;+1;;;;;+3/p-4 |
| InChIKey | LFWZMGWJMSUMBD-UHFFFAOYSA-J |
| XLogP | -9.99 |
| TPSA | 219.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | -9.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|