C10H17NO9-2 — CID 4083059
2-[carboxylatomethyl(2,3,4,5,6-pentahydroxyhexyl)amino]acetate (PubChem CID 4083059) has the molecular formula C10H17NO9-2 and a molecular weight of 295.24 g/mol. Its IUPAC name is 2-[carboxylatomethyl(2,3,4,5,6-pentahydroxyhexyl)amino]acetate.
| Compound Name | 2-[carboxylatomethyl(2,3,4,5,6-pentahydroxyhexyl)amino]acetate |
|---|---|
| PubChem CID | 4083059 |
| Molecular Formula | C10H17NO9-2 |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[carboxylatomethyl(2,3,4,5,6-pentahydroxyhexyl)amino]acetate |
| SMILES | O=C([O-])CN(CC(=O)[O-])CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C10H19NO9/c12-4-6(14)10(20)9(19)5(13)1-11(2-7(15)16)3-8(17)18/h5-6,9-10,12-14,19-20H,1-4H2,(H,15,16)(H,17,18)/p-2 |
| InChIKey | NNJYRENMDXLMEC-UHFFFAOYSA-L |
| XLogP | -6.78 |
| TPSA | 184.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | -6.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |