C8H13O8- — CID 22706768
4,5,6,7,8-pentahydroxy-2-oxooctanoate (PubChem CID 22706768) has the molecular formula C8H13O8- and a molecular weight of 237.18 g/mol. Its IUPAC name is 4,5,6,7,8-pentahydroxy-2-oxooctanoate.
| Compound Name | 4,5,6,7,8-pentahydroxy-2-oxooctanoate |
|---|---|
| PubChem CID | 22706768 |
| Molecular Formula | C8H13O8- |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4,5,6,7,8-pentahydroxy-2-oxooctanoate |
| SMILES | O=C([O-])C(=O)CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H14O8/c9-2-5(12)7(14)6(13)3(10)1-4(11)8(15)16/h3,5-7,9-10,12-14H,1-2H2,(H,15,16)/p-1 |
| InChIKey | KYQCXUMVJGMDNG-UHFFFAOYSA-M |
| XLogP | -4.87 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|