C6H11O6- — CID 52940108
(3R,4S,5R)-3,4,5,6-tetrahydroxyhexanoate (PubChem CID 52940108) has the molecular formula C6H11O6- and a molecular weight of 179.15 g/mol. Its IUPAC name is (3R,4S,5R)-3,4,5,6-tetrahydroxyhexanoate.
| Compound Name | (3R,4S,5R)-3,4,5,6-tetrahydroxyhexanoate |
|---|---|
| PubChem CID | 52940108 |
| Molecular Formula | C6H11O6- |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | (3R,4S,5R)-3,4,5,6-tetrahydroxyhexanoate |
| SMILES | O=C([O-])C[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6/c7-2-4(9)6(12)3(8)1-5(10)11/h3-4,6-9,12H,1-2H2,(H,10,11)/p-1/t3-,4-,6+/m1/s1 |
| InChIKey | PALQXFMLVVWXFD-KODRXGBYSA-M |
| XLogP | -3.80 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |