C10H20CuO10 — CID 159153251
copper;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;diacetate (PubChem CID 159153251) has the molecular formula C10H20CuO10 and a molecular weight of 363.81 g/mol. Its IUPAC name is copper;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;diacetate.
| Compound Name | copper;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;diacetate |
|---|---|
| PubChem CID | 159153251 |
| Molecular Formula | C10H20CuO10 |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | copper;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO.[Cu+2] |
| InChI | InChI=1S/C6H14O6.2C2H4O2.Cu/c7-1-3(9)5(11)6(12)4(10)2-8;2*1-2(3)4;/h3-12H,1-2H2;2*1H3,(H,3,4);/q;;;+2/p-2/t3-,4+,5-,6-;;;/m1.../s1 |
| InChIKey | KJONJABYKFXFQE-AZAVZNNYSA-L |
| XLogP | -6.08 |
| TPSA | 201.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | -6.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |