C14H24O14Zr — CID 22810842
(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one;zirconium(4+);tetraacetate (PubChem CID 22810842) has the molecular formula C14H24O14Zr and a molecular weight of 507.56 g/mol. Its IUPAC name is (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one;zirconium(4+);tetraacetate.
| Compound Name | (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one;zirconium(4+);tetraacetate |
|---|---|
| PubChem CID | 22810842 |
| Molecular Formula | C14H24O14Zr |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one;zirconium(4+);tetraacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].O=C(CO)[C@@H](O)[C@H](O)[C@H](O)CO.[Zr+4] |
| InChI | InChI=1S/C6H12O6.4C2H4O2.Zr/c7-1-3(9)5(11)6(12)4(10)2-8;4*1-2(3)4;/h3,5-9,11-12H,1-2H2;4*1H3,(H,3,4);/q;;;;;+4/p-4/t3-,5-,6-;;;;;/m1...../s1 |
| InChIKey | ZEHLMOMFXVZFNI-JIDLYLTPSA-J |
| XLogP | -8.35 |
| TPSA | 278.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | -8.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |