C6H15NO6 — CID 22315777
azane;1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 22315777) has the molecular formula C6H15NO6 and a molecular weight of 197.19 g/mol. Its IUPAC name is azane;1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | azane;1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 22315777 |
| Molecular Formula | C6H15NO6 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | azane;1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | N.O=C(CO)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.H3N/c7-1-3(9)5(11)6(12)4(10)2-8;/h3,5-9,11-12H,1-2H2;1H3 |
| InChIKey | KGHNWUSKWGTNAA-UHFFFAOYSA-N |
| XLogP | -3.22 |
| TPSA | 153.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |