C7H17N3O6 — CID 87184988
guanidine;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 87184988) has the molecular formula C7H17N3O6 and a molecular weight of 239.23 g/mol. Its IUPAC name is guanidine;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | guanidine;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 87184988 |
| Molecular Formula | C7H17N3O6 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | guanidine;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | O=C(CO)[C@H](O)[C@@H](O)[C@H](O)CO.[H]N=C(N)N |
| InChI | InChI=1S/C6H12O6.CH5N3/c7-1-3(9)5(11)6(12)4(10)2-8;2-1(3)4/h3,5-9,11-12H,1-2H2;(H5,2,3,4)/t3-,5+,6+;/m1./s1 |
| InChIKey | AIUBSMPIVAMHCO-QEQRQOETSA-N |
| XLogP | -4.54 |
| TPSA | 194.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -4.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|