C6H14O11P2+2 — CID 174485633
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 174485633) has the molecular formula C6H14O11P2+2 and a molecular weight of 324.12 g/mol. Its IUPAC name is hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 174485633 |
| Molecular Formula | C6H14O11P2+2 |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | O=C(CO)C(O)C(O)C(O)CO.O=[P+](O)O[P+](=O)O |
| InChI | InChI=1S/C6H12O6.O5P2/c7-1-3(9)5(11)6(12)4(10)2-8;1-6(2)5-7(3)4/h3,5-9,11-12H,1-2H2;/p+2 |
| InChIKey | HFIYTWCYBCSZJU-UHFFFAOYSA-P |
| XLogP | -3.07 |
| TPSA | 202.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|