C12H24FeO12+3 — CID 157392156
iron(3+);bis((3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one) (PubChem CID 157392156) has the molecular formula C12H24FeO12+3 and a molecular weight of 416.16 g/mol. Its IUPAC name is iron(3+);bis((3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one).
| Compound Name | iron(3+);bis((3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one) |
|---|---|
| PubChem CID | 157392156 |
| Molecular Formula | C12H24FeO12+3 |
| Molecular Weight | 416.16 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | iron(3+);bis((3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one) |
| SMILES | O=C(CO)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(CO)[C@@H](O)[C@H](O)[C@H](O)CO.[Fe+3] |
| InChI | InChI=1S/2C6H12O6.Fe/c2*7-1-3(9)5(11)6(12)4(10)2-8;/h2*3,5-9,11-12H,1-2H2;/q;;+3/t2*3-,5-,6-;/m11./s1 |
| InChIKey | BMDDJFCZWLOQMY-YMPCMKECSA-N |
| XLogP | -6.76 |
| TPSA | 236.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.16 |
| LogP ≤ 5 | -6.76 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|