C5H10O5 — CID 90469716
(3R,4R)-1,3,4,5-tetrahydroxy(113C)pentan-2-one (PubChem CID 90469716) has the molecular formula C5H10O5 and a molecular weight of 151.12 g/mol. Its IUPAC name is (3R,4R)-1,3,4,5-tetrahydroxy(113C)pentan-2-one.
| Compound Name | (3R,4R)-1,3,4,5-tetrahydroxy(113C)pentan-2-one |
|---|---|
| PubChem CID | 90469716 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (3R,4R)-1,3,4,5-tetrahydroxy(113C)pentan-2-one |
| SMILES | O=C([13CH2]O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5-/m1/s1/i2+1 |
| InChIKey | ZAQJHHRNXZUBTE-USGVHLPZSA-N |
| XLogP | -2.74 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |