C6H11ClO5 — CID 88727372
(3R,4R,5R)-4-chloro-1,3,5,6-tetrahydroxyhexan-2-one (PubChem CID 88727372) has the molecular formula C6H11ClO5 and a molecular weight of 198.60 g/mol. Its IUPAC name is (3R,4R,5R)-4-chloro-1,3,5,6-tetrahydroxyhexan-2-one.
| Compound Name | (3R,4R,5R)-4-chloro-1,3,5,6-tetrahydroxyhexan-2-one |
|---|---|
| PubChem CID | 88727372 |
| Molecular Formula | C6H11ClO5 |
| Molecular Weight | 198.60 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | (3R,4R,5R)-4-chloro-1,3,5,6-tetrahydroxyhexan-2-one |
| SMILES | O=C(CO)[C@@H](O)[C@H](Cl)[C@H](O)CO |
| InChI | InChI=1S/C6H11ClO5/c7-5(3(10)1-8)6(12)4(11)2-9/h3,5-6,8-10,12H,1-2H2/t3-,5-,6-/m1/s1 |
| InChIKey | JBIQXKYIGHDIID-UYFOZJQFSA-N |
| XLogP | -2.13 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.60 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|