C10H19NO9 — CID 4083060
2-[carboxymethyl(2,3,4,5,6-pentahydroxyhexyl)amino]acetic acid (PubChem CID 4083060) has the molecular formula C10H19NO9 and a molecular weight of 297.26 g/mol. Its IUPAC name is 2-[carboxymethyl(2,3,4,5,6-pentahydroxyhexyl)amino]acetic acid.
| Compound Name | 2-[carboxymethyl(2,3,4,5,6-pentahydroxyhexyl)amino]acetic acid |
|---|---|
| PubChem CID | 4083060 |
| Molecular Formula | C10H19NO9 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[carboxymethyl(2,3,4,5,6-pentahydroxyhexyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C10H19NO9/c12-4-6(14)10(20)9(19)5(13)1-11(2-7(15)16)3-8(17)18/h5-6,9-10,12-14,19-20H,1-4H2,(H,15,16)(H,17,18) |
| InChIKey | NNJYRENMDXLMEC-UHFFFAOYSA-N |
| XLogP | -4.11 |
| TPSA | 178.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |