C16H26N2O15 — CID 173095914
(2R,3S,4R,5R)-2-[1,2-bis[bis(carboxymethyl)amino]ethyl]-2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 173095914) has the molecular formula C16H26N2O15 and a molecular weight of 486.38 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[1,2-bis[bis(carboxymethyl)amino]ethyl]-2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | (2R,3S,4R,5R)-2-[1,2-bis[bis(carboxymethyl)amino]ethyl]-2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 173095914 |
| Molecular Formula | C16H26N2O15 |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | (2R,3S,4R,5R)-2-[1,2-bis[bis(carboxymethyl)amino]ethyl]-2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | O=C(O)CN(CC(=O)O)CC(N(CC(=O)O)CC(=O)O)[C@](O)(C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H26N2O15/c19-6-7(20)13(29)14(30)16(33,15(31)32)8(18(4-11(25)26)5-12(27)28)1-17(2-9(21)22)3-10(23)24/h7-8,13-14,19-20,29-30,33H,1-6H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28)(H,31,32)/t7-,8?,13-,14+,16-/m1/s1 |
| InChIKey | GECHUSPDQJGBOS-ORFGHFSCSA-N |
| XLogP | -5.81 |
| TPSA | 294.13 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | -5.81 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |