C8H15NO8 — CID 89051494
(2R,3R,4S,5R)-2-acetamido-2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 89051494) has the molecular formula C8H15NO8 and a molecular weight of 253.21 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-acetamido-2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | (2R,3R,4S,5R)-2-acetamido-2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 89051494 |
| Molecular Formula | C8H15NO8 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (2R,3R,4S,5R)-2-acetamido-2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | CC(=O)N[C@](O)(C(=O)O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H15NO8/c1-3(11)9-8(17,7(15)16)6(14)5(13)4(12)2-10/h4-6,10,12-14,17H,2H2,1H3,(H,9,11)(H,15,16)/t4-,5+,6-,8-/m1/s1 |
| InChIKey | YJGKPTMXTARSBZ-BYPJNBLXSA-N |
| XLogP | -4.03 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|