C10H20O6 — CID 87557988
(2S,3S,4R,5R)-2-but-2-en-2-ylhexane-1,2,3,4,5,6-hexol (PubChem CID 87557988) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-but-2-en-2-ylhexane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3S,4R,5R)-2-but-2-en-2-ylhexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 87557988 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (2S,3S,4R,5R)-2-but-2-en-2-ylhexane-1,2,3,4,5,6-hexol |
| SMILES | CC=C(C)[C@](O)(CO)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H20O6/c1-3-6(2)10(16,5-12)9(15)8(14)7(13)4-11/h3,7-9,11-16H,4-5H2,1-2H3/t7-,8-,9+,10-/m1/s1 |
| InChIKey | SQZFAMHUJVADFH-DOLQZWNJSA-N |
| XLogP | -2.25 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|