C8H15NO6 — CID 174573561
(2S,3R,4S,5R)-2-acetyl-2-amino-3,4,5,6-tetrahydroxyhexanal (PubChem CID 174573561) has the molecular formula C8H15NO6 and a molecular weight of 221.21 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-acetyl-2-amino-3,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2S,3R,4S,5R)-2-acetyl-2-amino-3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 174573561 |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | (2S,3R,4S,5R)-2-acetyl-2-amino-3,4,5,6-tetrahydroxyhexanal |
| SMILES | CC(=O)[C@@](N)(C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H15NO6/c1-4(12)8(9,3-11)7(15)6(14)5(13)2-10/h3,5-7,10,13-15H,2,9H2,1H3/t5-,6-,7+,8+/m1/s1 |
| InChIKey | QYAFYVFGCKREIO-NGJRWZKOSA-N |
| XLogP | -3.45 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|