C10H17NO8 — CID 141249710
N-acetyl-N-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-oxohexan-2-yl]acetamide (PubChem CID 141249710) has the molecular formula C10H17NO8 and a molecular weight of 279.25 g/mol. Its IUPAC name is N-acetyl-N-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-oxohexan-2-yl]acetamide.
| Compound Name | N-acetyl-N-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-oxohexan-2-yl]acetamide |
|---|---|
| PubChem CID | 141249710 |
| Molecular Formula | C10H17NO8 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-acetyl-N-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-oxohexan-2-yl]acetamide |
| SMILES | CC(=O)N(C(C)=O)[C@](O)(C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H17NO8/c1-5(14)11(6(2)15)10(19,4-13)9(18)8(17)7(16)3-12/h4,7-9,12,16-19H,3H2,1-2H3/t7-,8-,9+,10+/m1/s1 |
| InChIKey | IHOAJZXSLWNNDY-IMSYWVGJSA-N |
| XLogP | -3.66 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|