C7H12O6 — CID 20638965
(2S,3R,4R)-2-acetyl-2,3,4,5-tetrahydroxypentanal (PubChem CID 20638965) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is (2S,3R,4R)-2-acetyl-2,3,4,5-tetrahydroxypentanal.
| Compound Name | (2S,3R,4R)-2-acetyl-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 20638965 |
| Molecular Formula | C7H12O6 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (2S,3R,4R)-2-acetyl-2,3,4,5-tetrahydroxypentanal |
| SMILES | CC(=O)[C@@](O)(C=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H12O6/c1-4(10)7(13,3-9)6(12)5(11)2-8/h3,5-6,8,11-13H,2H2,1H3/t5-,6-,7+/m1/s1 |
| InChIKey | QCIWCJSJDOBRHF-QYNIQEEDSA-N |
| XLogP | -2.78 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|