C7H16O6 — CID 54330413
(2R,3R,4R,5R)-3-methylhexane-1,2,3,4,5,6-hexol (PubChem CID 54330413) has the molecular formula C7H16O6 and a molecular weight of 196.20 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3-methylhexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4R,5R)-3-methylhexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 54330413 |
| Molecular Formula | C7H16O6 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (2R,3R,4R,5R)-3-methylhexane-1,2,3,4,5,6-hexol |
| SMILES | C[C@@](O)([C@H](O)CO)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H16O6/c1-7(13,5(11)3-9)6(12)4(10)2-8/h4-6,8-13H,2-3H2,1H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | SXYJOSUUQAWDDF-DBRKOABJSA-N |
| XLogP | -3.20 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |