C10H20O6 — CID 22600717
4,5,6,7-tetrahydroxy-3-methoxy-3,4-dimethylheptan-2-one (PubChem CID 22600717) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is 4,5,6,7-tetrahydroxy-3-methoxy-3,4-dimethylheptan-2-one.
| Compound Name | 4,5,6,7-tetrahydroxy-3-methoxy-3,4-dimethylheptan-2-one |
|---|---|
| PubChem CID | 22600717 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4,5,6,7-tetrahydroxy-3-methoxy-3,4-dimethylheptan-2-one |
| SMILES | COC(C)(C(C)=O)C(C)(O)C(O)C(O)CO |
| InChI | InChI=1S/C10H20O6/c1-6(12)10(3,16-4)9(2,15)8(14)7(13)5-11/h7-8,11,13-15H,5H2,1-4H3 |
| InChIKey | SUOHQGCCFSEWJG-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |