C10H16O6 — CID 141176566
4-methyl-4-(1,2,3-trihydroxypropyl)hexane-2,3,5-trione (PubChem CID 141176566) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is 4-methyl-4-(1,2,3-trihydroxypropyl)hexane-2,3,5-trione.
| Compound Name | 4-methyl-4-(1,2,3-trihydroxypropyl)hexane-2,3,5-trione |
|---|---|
| PubChem CID | 141176566 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 4-methyl-4-(1,2,3-trihydroxypropyl)hexane-2,3,5-trione |
| SMILES | CC(=O)C(=O)C(C)(C(C)=O)C(O)C(O)CO |
| InChI | InChI=1S/C10H16O6/c1-5(12)8(15)10(3,6(2)13)9(16)7(14)4-11/h7,9,11,14,16H,4H2,1-3H3 |
| InChIKey | QNAZXYVDVJRZDE-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|