C14H20O9 — CID 118970880
[(4S,5S,6S,7R)-4,5-diacetyl-6,7,8-trihydroxy-2,3-dioxooctan-4-yl] acetate (PubChem CID 118970880) has the molecular formula C14H20O9 and a molecular weight of 332.31 g/mol. Its IUPAC name is [(4S,5S,6S,7R)-4,5-diacetyl-6,7,8-trihydroxy-2,3-dioxooctan-4-yl] acetate.
| Compound Name | [(4S,5S,6S,7R)-4,5-diacetyl-6,7,8-trihydroxy-2,3-dioxooctan-4-yl] acetate |
|---|---|
| PubChem CID | 118970880 |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | [(4S,5S,6S,7R)-4,5-diacetyl-6,7,8-trihydroxy-2,3-dioxooctan-4-yl] acetate |
| SMILES | CC(=O)O[C@@](C(C)=O)(C(=O)C(C)=O)[C@@H](C(C)=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H20O9/c1-6(16)11(12(21)10(20)5-15)14(8(3)18,23-9(4)19)13(22)7(2)17/h10-12,15,20-21H,5H2,1-4H3/t10-,11+,12-,14-/m1/s1 |
| InChIKey | WXKRSGCDSFYURQ-GFQSEFKGSA-N |
| XLogP | -2.05 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|