C13H18O9 — CID 87243073
[(2R,3R,4S)-3,4-diacetyl-1,2,3-trihydroxy-5,6-dioxoheptan-4-yl] acetate (PubChem CID 87243073) has the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-diacetyl-1,2,3-trihydroxy-5,6-dioxoheptan-4-yl] acetate.
| Compound Name | [(2R,3R,4S)-3,4-diacetyl-1,2,3-trihydroxy-5,6-dioxoheptan-4-yl] acetate |
|---|---|
| PubChem CID | 87243073 |
| Molecular Formula | C13H18O9 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | [(2R,3R,4S)-3,4-diacetyl-1,2,3-trihydroxy-5,6-dioxoheptan-4-yl] acetate |
| SMILES | CC(=O)O[C@@](C(C)=O)(C(=O)C(C)=O)[C@@](O)(C(C)=O)[C@H](O)CO |
| InChI | InChI=1S/C13H18O9/c1-6(15)11(20)13(8(3)17,22-9(4)18)12(21,7(2)16)10(19)5-14/h10,14,19,21H,5H2,1-4H3/t10-,12-,13+/m1/s1 |
| InChIKey | SKWDYLGAVSPPPJ-RTXFEEFZSA-N |
| XLogP | -2.29 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|