C8H14O10S — CID 142634818
(2R,3R,4R,5R)-1,2,3,4,5-pentahydroxy-6,7-dioxooctane-3-sulfonic acid (PubChem CID 142634818) has the molecular formula C8H14O10S and a molecular weight of 302.26 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1,2,3,4,5-pentahydroxy-6,7-dioxooctane-3-sulfonic acid.
| Compound Name | (2R,3R,4R,5R)-1,2,3,4,5-pentahydroxy-6,7-dioxooctane-3-sulfonic acid |
|---|---|
| PubChem CID | 142634818 |
| Molecular Formula | C8H14O10S |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | (2R,3R,4R,5R)-1,2,3,4,5-pentahydroxy-6,7-dioxooctane-3-sulfonic acid |
| SMILES | CC(=O)C(=O)[C@H](O)[C@@H](O)[C@@](O)([C@H](O)CO)S(=O)(=O)O |
| InChI | InChI=1S/C8H14O10S/c1-3(10)5(12)6(13)7(14)8(15,4(11)2-9)19(16,17)18/h4,6-7,9,11,13-15H,2H2,1H3,(H,16,17,18)/t4-,6+,7-,8-/m1/s1 |
| InChIKey | IRYLCCAYFBECNH-PXBUCIJWSA-N |
| XLogP | -4.20 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|