C8H16O4 — CID 101111956
(3R,4R)-1,3,4-trihydroxy-5,5-dimethylhexan-2-one (PubChem CID 101111956) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is (3R,4R)-1,3,4-trihydroxy-5,5-dimethylhexan-2-one.
| Compound Name | (3R,4R)-1,3,4-trihydroxy-5,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 101111956 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (3R,4R)-1,3,4-trihydroxy-5,5-dimethylhexan-2-one |
| SMILES | CC(C)(C)[C@@H](O)[C@@H](O)C(=O)CO |
| InChI | InChI=1S/C8H16O4/c1-8(2,3)7(12)6(11)5(10)4-9/h6-7,9,11-12H,4H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | MWTQTXOKYRLVRF-BQBZGAKWSA-N |
| XLogP | -0.68 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |