C6H10O5 — CID 15506784
1,3,4-trihydroxyhexane-2,5-dione (PubChem CID 15506784) has the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. Its IUPAC name is 1,3,4-trihydroxyhexane-2,5-dione.
| Compound Name | 1,3,4-trihydroxyhexane-2,5-dione |
|---|---|
| PubChem CID | 15506784 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 1,3,4-trihydroxyhexane-2,5-dione |
| SMILES | CC(=O)C(O)C(O)C(=O)CO |
| InChI | InChI=1S/C6H10O5/c1-3(8)5(10)6(11)4(9)2-7/h5-7,10-11H,2H2,1H3 |
| InChIKey | KFHNTUHHTDAEOF-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |