C6H11NO5 — CID 59039789
(3R,4R,5Z)-3,4,6-trihydroxy-5-hydroxyiminohexan-2-one (PubChem CID 59039789) has the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. Its IUPAC name is (3R,4R,5Z)-3,4,6-trihydroxy-5-hydroxyiminohexan-2-one.
| Compound Name | (3R,4R,5Z)-3,4,6-trihydroxy-5-hydroxyiminohexan-2-one |
|---|---|
| PubChem CID | 59039789 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (3R,4R,5Z)-3,4,6-trihydroxy-5-hydroxyiminohexan-2-one |
| SMILES | CC(=O)[C@H](O)[C@H](O)/C(CO)=N\O |
| InChI | InChI=1S/C6H11NO5/c1-3(9)5(10)6(11)4(2-8)7-12/h5-6,8,10-12H,2H2,1H3/b7-4-/t5-,6+/m0/s1 |
| InChIKey | IXGFGQOBSIBOKG-CFDJTYOJSA-N |
| XLogP | -1.88 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|