C6H13NO2 — CID 138626459
(3R,4S)-4-amino-3-hydroxyhexan-2-one (PubChem CID 138626459) has the molecular formula C6H13NO2 and a molecular weight of 131.17 g/mol. Its IUPAC name is (3R,4S)-4-amino-3-hydroxyhexan-2-one.
| Compound Name | (3R,4S)-4-amino-3-hydroxyhexan-2-one |
|---|---|
| PubChem CID | 138626459 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (3R,4S)-4-amino-3-hydroxyhexan-2-one |
| SMILES | CC[C@H](N)[C@@H](O)C(C)=O |
| InChI | InChI=1S/C6H13NO2/c1-3-5(7)6(9)4(2)8/h5-6,9H,3,7H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | VBMOPPRWCSSERV-WDSKDSINSA-N |
| XLogP | -0.33 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |