C6H16N2 — CID 12656175
hexane-3,4-diamine (PubChem CID 12656175) has the molecular formula C6H16N2 and a molecular weight of 116.21 g/mol. Its IUPAC name is hexane-3,4-diamine.
| Compound Name | hexane-3,4-diamine |
|---|---|
| PubChem CID | 12656175 |
| Molecular Formula | C6H16N2 |
| Molecular Weight | 116.21 g/mol |
| Exact Mass | 116.13 |
| IUPAC Name | hexane-3,4-diamine |
| SMILES | CCC(N)C(N)CC |
| InChI | InChI=1S/C6H16N2/c1-3-5(7)6(8)4-2/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | IWCAQTQMDRGMPI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |