C6H16ClNO2 — CID 86775568
1,1-dimethoxybutan-2-amine;hydrochloride (PubChem CID 86775568) has the molecular formula C6H16ClNO2 and a molecular weight of 169.65 g/mol. Its IUPAC name is 1,1-dimethoxybutan-2-amine;hydrochloride.
| Compound Name | 1,1-dimethoxybutan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 86775568 |
| Molecular Formula | C6H16ClNO2 |
| Molecular Weight | 169.65 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 1,1-dimethoxybutan-2-amine;hydrochloride |
| SMILES | CCC(N)C(OC)OC.Cl |
| InChI | InChI=1S/C6H15NO2.ClH/c1-4-5(7)6(8-2)9-3;/h5-6H,4,7H2,1-3H3;1H |
| InChIKey | BQOQGQLXRDLTLQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.65 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|