About 1,1-dimethoxybutan-2-amine;hydrochloride
1,1-dimethoxybutan-2-amine;hydrochloride (PubChem CID 86775568) has the molecular formula C6H16ClNO2
and a molecular weight of 169.65 g/mol. Its IUPAC name is 1,1-dimethoxybutan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 1,1-dimethoxybutan-2-amine;hydrochloride |
| PubChem CID | 86775568 |
| Molecular Formula | C6H16ClNO2 |
| Molecular Weight | 169.65 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 1,1-dimethoxybutan-2-amine;hydrochloride |
| SMILES | CCC(N)C(OC)OC.Cl |
| InChI | InChI=1S/C6H15NO2.ClH/c1-4-5(7)6(8-2)9-3;/h5-6H,4,7H2,1-3H3;1H |
| InChIKey | BQOQGQLXRDLTLQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.65 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxybutan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxybutan-2-amine;hydrochloride?
The IUPAC name of 1,1-dimethoxybutan-2-amine;hydrochloride (CID 86775568) is 1,1-dimethoxybutan-2-amine;hydrochloride.
What is the SMILES notation for 1,1-dimethoxybutan-2-amine;hydrochloride?
The canonical SMILES for 1,1-dimethoxybutan-2-amine;hydrochloride is CCC(N)C(OC)OC.Cl.
What is the InChIKey of 1,1-dimethoxybutan-2-amine;hydrochloride?
The InChIKey is BQOQGQLXRDLTLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2.ClH/c1-4-5(7)6(8-2)9-3;/h5-6H,4,7H2,1-3H3;1H.
What are the key properties of 1,1-dimethoxybutan-2-amine;hydrochloride?
1,1-dimethoxybutan-2-amine;hydrochloride has a molecular weight of 169.65 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxybutan-2-amine;hydrochloride is sourced from PubChem (CID 86775568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).