C9H21N — CID 163978078
(3R)-4,5-dimethylheptan-3-amine (PubChem CID 163978078) has the molecular formula C9H21N and a molecular weight of 143.27 g/mol. Its IUPAC name is (3R)-4,5-dimethylheptan-3-amine.
| Compound Name | (3R)-4,5-dimethylheptan-3-amine |
|---|---|
| PubChem CID | 163978078 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | (3R)-4,5-dimethylheptan-3-amine |
| SMILES | CCC(C)C(C)[C@H](N)CC |
| InChI | InChI=1S/C9H21N/c1-5-7(3)8(4)9(10)6-2/h7-9H,5-6,10H2,1-4H3/t7?,8?,9-/m1/s1 |
| InChIKey | SVXPJHWSGQFNJB-AMDVSUOASA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |