C8H18N2O — CID 131230677
2-amino-3,4-dimethylhexanamide (PubChem CID 131230677) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-amino-3,4-dimethylhexanamide.
| Compound Name | 2-amino-3,4-dimethylhexanamide |
|---|---|
| PubChem CID | 131230677 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 2-amino-3,4-dimethylhexanamide |
| SMILES | CCC(C)C(C)C(N)C(N)=O |
| InChI | InChI=1S/C8H18N2O/c1-4-5(2)6(3)7(9)8(10)11/h5-7H,4,9H2,1-3H3,(H2,10,11) |
| InChIKey | PDTRNBLMHQINGU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |