About 2-amino-3,4-dimethylhexanamide
2-amino-3,4-dimethylhexanamide (PubChem CID 131230677) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-amino-3,4-dimethylhexanamide.
Molecular Properties
| Compound Name | 2-amino-3,4-dimethylhexanamide |
| PubChem CID | 131230677 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 2-amino-3,4-dimethylhexanamide |
| SMILES | CCC(C)C(C)C(N)C(N)=O |
| InChI | InChI=1S/C8H18N2O/c1-4-5(2)6(3)7(9)8(10)11/h5-7H,4,9H2,1-3H3,(H2,10,11) |
| InChIKey | PDTRNBLMHQINGU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-3,4-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,4-dimethylhexanamide?
The IUPAC name of 2-amino-3,4-dimethylhexanamide (CID 131230677) is 2-amino-3,4-dimethylhexanamide.
What is the SMILES notation for 2-amino-3,4-dimethylhexanamide?
The canonical SMILES for 2-amino-3,4-dimethylhexanamide is CCC(C)C(C)C(N)C(N)=O.
What is the InChIKey of 2-amino-3,4-dimethylhexanamide?
The InChIKey is PDTRNBLMHQINGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-4-5(2)6(3)7(9)8(10)11/h5-7H,4,9H2,1-3H3,(H2,10,11).
What are the key properties of 2-amino-3,4-dimethylhexanamide?
2-amino-3,4-dimethylhexanamide has a molecular weight of 158.24 g/mol, XLogP of 0.48, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,4-dimethylhexanamide is sourced from PubChem (CID 131230677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).