C7H15NO — CID 170847775
(2R,3R)-2,3-dimethylpentanamide (PubChem CID 170847775) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is (2R,3R)-2,3-dimethylpentanamide.
| Compound Name | (2R,3R)-2,3-dimethylpentanamide |
|---|---|
| PubChem CID | 170847775 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (2R,3R)-2,3-dimethylpentanamide |
| SMILES | CC[C@@H](C)[C@@H](C)C(N)=O |
| InChI | InChI=1S/C7H15NO/c1-4-5(2)6(3)7(8)9/h5-6H,4H2,1-3H3,(H2,8,9)/t5-,6-/m1/s1 |
| InChIKey | HRBAJVQRJUTNMM-PHDIDXHHSA-N |
| XLogP | 1.15 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |