C6H15ClN2O — CID 139063739
[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]azanium chloride (PubChem CID 139063739) has the molecular formula C6H15ClN2O and a molecular weight of 166.65 g/mol. Its IUPAC name is [(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]azanium chloride.
| Compound Name | [(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 139063739 |
| Molecular Formula | C6H15ClN2O |
| Molecular Weight | 166.65 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | [(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]azanium chloride |
| SMILES | CC[C@H](C)[C@H]([NH3+])C(N)=O.[Cl-] |
| InChI | InChI=1S/C6H14N2O.ClH/c1-3-4(2)5(7)6(8)9;/h4-5H,3,7H2,1-2H3,(H2,8,9);1H/t4-,5-;/m0./s1 |
| InChIKey | SAOZPTBFWAEJQL-FHAQVOQBSA-N |
| XLogP | -3.87 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.65 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |