C7H18N2O2 — CID 88699485
2,3-dimethylpentanamide;hydroxylamine (PubChem CID 88699485) has the molecular formula C7H18N2O2 and a molecular weight of 162.23 g/mol. Its IUPAC name is 2,3-dimethylpentanamide;hydroxylamine.
| Compound Name | 2,3-dimethylpentanamide;hydroxylamine |
|---|---|
| PubChem CID | 88699485 |
| Molecular Formula | C7H18N2O2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 2,3-dimethylpentanamide;hydroxylamine |
| SMILES | CCC(C)C(C)C(N)=O.NO |
| InChI | InChI=1S/C7H15NO.H3NO/c1-4-5(2)6(3)7(8)9;1-2/h5-6H,4H2,1-3H3,(H2,8,9);2H,1H2 |
| InChIKey | FOAHCXUCDDYOEF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|