C12H28N2O — CID 22928550
2-amino-3-methylpentanamide;2,3-dimethylbutane (PubChem CID 22928550) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-amino-3-methylpentanamide;2,3-dimethylbutane.
| Compound Name | 2-amino-3-methylpentanamide;2,3-dimethylbutane |
|---|---|
| PubChem CID | 22928550 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | 2-amino-3-methylpentanamide;2,3-dimethylbutane |
| SMILES | CC(C)C(C)C.CCC(C)C(N)C(N)=O |
| InChI | InChI=1S/C6H14N2O.C6H14/c1-3-4(2)5(7)6(8)9;1-5(2)6(3)4/h4-5H,3,7H2,1-2H3,(H2,8,9);5-6H,1-4H3 |
| InChIKey | OMRFGVVQTZDGHG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |